C22H29NO7S — CID 53384268
dimethyl (2R)-1-(4-methylphenyl)sulfonyl-2-(2-oxopropyl)-3a,4,5,6,7,7a-hexahydro-2H-indole-3,3-dicarboxylate (PubChem CID 53384268) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is dimethyl (2R)-1-(4-methylphenyl)sulfonyl-2-(2-oxopropyl)-3a,4,5,6,7,7a-hexahydro-2H-indole-3,3-dicarboxylate.
| Compound Name | dimethyl (2R)-1-(4-methylphenyl)sulfonyl-2-(2-oxopropyl)-3a,4,5,6,7,7a-hexahydro-2H-indole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 53384268 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | dimethyl (2R)-1-(4-methylphenyl)sulfonyl-2-(2-oxopropyl)-3a,4,5,6,7,7a-hexahydro-2H-indole-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C2CCCCC2N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CC(C)=O |
| InChI | InChI=1S/C22H29NO7S/c1-14-9-11-16(12-10-14)31(27,28)23-18-8-6-5-7-17(18)22(20(25)29-3,21(26)30-4)19(23)13-15(2)24/h9-12,17-19H,5-8,13H2,1-4H3/t17?,18?,19-/m1/s1 |
| InChIKey | YXUQQZMXMFBCCI-CTWPCTMYSA-N |
| XLogP | 2.24 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|