C35H29N2NaO7S2 — CID 53384278
sodium 4-[6-(2,6-dimethylanilino)-9-(2-sulfonatophenyl)xanthen-3-ylidene]azaniumyl-3,5-dimethylbenzenesulfonate (PubChem CID 53384278) has the molecular formula C35H29N2NaO7S2 and a molecular weight of 676.75 g/mol. Its IUPAC name is sodium 4-[6-(2,6-dimethylanilino)-9-(2-sulfonatophenyl)xanthen-3-ylidene]azaniumyl-3,5-dimethylbenzenesulfonate.
| Compound Name | sodium 4-[6-(2,6-dimethylanilino)-9-(2-sulfonatophenyl)xanthen-3-ylidene]azaniumyl-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 53384278 |
| Molecular Formula | C35H29N2NaO7S2 |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | sodium 4-[6-(2,6-dimethylanilino)-9-(2-sulfonatophenyl)xanthen-3-ylidene]azaniumyl-3,5-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(C)c1Nc1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[NH+]\c4c(C)cc(S(=O)(=O)[O-])cc4C)cc-3oc2c1.[Na+] |
| InChI | InChI=1S/C35H30N2O7S2.Na/c1-20-8-7-9-21(2)34(20)36-24-12-14-27-30(18-24)44-31-19-25(37-35-22(3)16-26(17-23(35)4)45(38,39)40)13-15-28(31)33(27)29-10-5-6-11-32(29)46(41,42)43;/h5-19,36H,1-4H3,(H,38,39,40)(H,41,42,43);/q;+1/p-1/b37-25+; |
| InChIKey | VFJTXNQNKLNYDE-XFQLUCEVSA-M |
| XLogP | 2.31 |
| TPSA | 153.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|