About 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene)
2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) (PubChem CID 53384287) has the molecular formula C75H44
and a molecular weight of 945.10 g/mol. Its IUPAC name is 2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene].
Molecular Properties
| Compound Name | 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) |
| PubChem CID | 53384287 |
| Molecular Formula | C75H44 |
| Molecular Weight | 945.10 g/mol |
| Exact Mass | 944.34 |
| IUPAC Name | 2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene] |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)C7=CC8=C(C=C7)C9=C(C81C2=CC=CC=C2C2=CC=CC=C12)C=C(C=C9)C1=CC2=C(C=C1)C1=CC=CC=C1C21C2=CC=CC=C2C2=CC=CC=C12 |
| InChI | InChI=1S/C75H44/c1-9-25-61-49(17-1)50-18-2-10-26-62(50)73(61)65-29-13-7-23-55(65)57-37-33-45(41-69(57)73)47-35-39-59-60-40-36-48(44-72(60)75(71(59)43-47)67-31-15-5-21-53(67)54-22-6-16-32-68(54)75)46-34-38-58-56-24-8-14-30-66(56)74(70(58)42-46)63-27-11-3-19-51(63)52-20-4-12-28-64(52)74/h1-44H |
| InChIKey | BFDFHGPJXDFXBA-UHFFFAOYSA-N |
| XLogP | 18.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 75 |
| Complexity | 1900 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 945.10 |
| LogP ≤ 5 | 18.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene)?
The IUPAC name of 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) (CID 53384287) is 2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene].
What is the SMILES notation for 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene)?
The canonical SMILES for 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) is C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)C7=CC8=C(C=C7)C9=C(C81C2=CC=CC=C2C2=CC=CC=C12)C=C(C=C9)C1=CC2=C(C=C1)C1=CC=CC=C1C21C2=CC=CC=C2C2=CC=CC=C12.
What is the InChIKey of 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene)?
The InChIKey is BFDFHGPJXDFXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C75H44/c1-9-25-61-49(17-1)50-18-2-10-26-62(50)73(61)65-29-13-7-23-55(65)57-37-33-45(41-69(57)73)47-35-39-59-60-40-36-48(44-72(60)75(71(59)43-47)67-31-15-5-21-53(67)54-22-6-16-32-68(54)75)46-34-38-58-56-24-8-14-30-66(56)74(70(58)42-46)63-27-11-3-19-51(63)52-20-4-12-28-64(52)74/h1-44H.
What are the key properties of 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene)?
2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) has a molecular weight of 945.10 g/mol, XLogP of 18.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'':7'',2''''-Ter-9,9'-spirobi(9H-fluorene) is sourced from PubChem (CID 53384287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).