C31H27N3O2S — CID 5338433
(5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-naphthalen-1-yl-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 5338433) has the molecular formula C31H27N3O2S and a molecular weight of 505.64 g/mol. Its IUPAC name is (5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-naphthalen-1-yl-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-naphthalen-1-yl-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 5338433 |
| Molecular Formula | C31H27N3O2S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (5Z)-5-[[4-(diethylamino)phenyl]methylidene]-1-naphthalen-1-yl-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN(CC)c1ccc(/C=C2/C(=O)N(c3ccccc3)C(=S)N(c3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C31H27N3O2S/c1-3-32(4-2)24-19-17-22(18-20-24)21-27-29(35)33(25-13-6-5-7-14-25)31(37)34(30(27)36)28-16-10-12-23-11-8-9-15-26(23)28/h5-21H,3-4H2,1-2H3/b27-21- |
| InChIKey | SZUJKUKJNUXFLT-MEFGMAGPSA-N |
| XLogP | 6.43 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|