About bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium
bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium (PubChem CID 53384372) has the molecular formula C13H26F6N2O4S2
and a molecular weight of 452.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium |
| PubChem CID | 53384372 |
| Molecular Formula | C13H26F6N2O4S2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium |
| SMILES | CCCCC[N+](CC)(CC)CC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H26N.C2F6NO4S2/c1-5-9-10-11-12(6-2,7-3)8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-11H2,1-4H3;/q+1;-1 |
| InChIKey | ALYCOCULEAWWJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium (CID 53384372) is bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium is CCCCC[N+](CC)(CC)CC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium?
The InChIKey is ALYCOCULEAWWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N.C2F6NO4S2/c1-5-9-10-11-12(6-2,7-3)8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-11H2,1-4H3;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium?
bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium has a molecular weight of 452.48 g/mol, XLogP of 4.11, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;triethyl(pentyl)azanium is sourced from PubChem (CID 53384372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).