About bis(2-amino-5-methylbenzenesulfonate);nickel(2+)
bis(2-amino-5-methylbenzenesulfonate);nickel(2+) (PubChem CID 53384453) has the molecular formula C14H16N2NiO6S2
and a molecular weight of 431.12 g/mol. Its IUPAC name is bis(2-amino-5-methylbenzenesulfonate);nickel(2+).
Molecular Properties
| Compound Name | bis(2-amino-5-methylbenzenesulfonate);nickel(2+) |
| PubChem CID | 53384453 |
| Molecular Formula | C14H16N2NiO6S2 |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | bis(2-amino-5-methylbenzenesulfonate);nickel(2+) |
| SMILES | Cc1ccc(N)c(S(=O)(=O)[O-])c1.Cc1ccc(N)c(S(=O)(=O)[O-])c1.[Ni+2] |
| InChI | InChI=1S/2C7H9NO3S.Ni/c2*1-5-2-3-6(8)7(4-5)12(9,10)11;/h2*2-4H,8H2,1H3,(H,9,10,11);/q;;+2/p-2 |
| InChIKey | JFVHHXOSEDMKHN-UHFFFAOYSA-L |
| XLogP | 0.96 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-amino-5-methylbenzenesulfonate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-amino-5-methylbenzenesulfonate);nickel(2+)?
The IUPAC name of bis(2-amino-5-methylbenzenesulfonate);nickel(2+) (CID 53384453) is bis(2-amino-5-methylbenzenesulfonate);nickel(2+).
What is the SMILES notation for bis(2-amino-5-methylbenzenesulfonate);nickel(2+)?
The canonical SMILES for bis(2-amino-5-methylbenzenesulfonate);nickel(2+) is Cc1ccc(N)c(S(=O)(=O)[O-])c1.Cc1ccc(N)c(S(=O)(=O)[O-])c1.[Ni+2].
What is the InChIKey of bis(2-amino-5-methylbenzenesulfonate);nickel(2+)?
The InChIKey is JFVHHXOSEDMKHN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H9NO3S.Ni/c2*1-5-2-3-6(8)7(4-5)12(9,10)11;/h2*2-4H,8H2,1H3,(H,9,10,11);/q;;+2/p-2.
What are the key properties of bis(2-amino-5-methylbenzenesulfonate);nickel(2+)?
bis(2-amino-5-methylbenzenesulfonate);nickel(2+) has a molecular weight of 431.12 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-amino-5-methylbenzenesulfonate);nickel(2+) is sourced from PubChem (CID 53384453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).