C8H6O6 — CID 53384481
(3R)-3-[(3S)-2,5-dioxooxolan-3-yl]oxolane-2,5-dione (PubChem CID 53384481) has the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. Its IUPAC name is (3R)-3-[(3S)-2,5-dioxooxolan-3-yl]oxolane-2,5-dione.
| Compound Name | (3R)-3-[(3S)-2,5-dioxooxolan-3-yl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 53384481 |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (3R)-3-[(3S)-2,5-dioxooxolan-3-yl]oxolane-2,5-dione |
| SMILES | O=C1C[C@@H]([C@H]2CC(=O)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C8H6O6/c9-5-1-3(7(11)13-5)4-2-6(10)14-8(4)12/h3-4H,1-2H2/t3-,4+ |
| InChIKey | OLQWMCSSZKNOLQ-ZXZARUISSA-N |
| XLogP | -0.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|