C20H18F4N2O3 — CID 53384835
N-tert-butyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 53384835) has the molecular formula C20H18F4N2O3 and a molecular weight of 410.37 g/mol. Its IUPAC name is N-tert-butyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-tert-butyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53384835 |
| Molecular Formula | C20H18F4N2O3 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-tert-butyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)NC(=O)c1ccc(C#Cc2cccc(F)c2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H17FN2O.C2HF3O2/c1-18(2,3)21-17(22)14-8-10-16(20-12-14)9-7-13-5-4-6-15(19)11-13;3-2(4,5)1(6)7/h4-6,8,10-12H,1-3H3,(H,21,22);(H,6,7) |
| InChIKey | UYUJFRHSDIHUDA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|