C20H16F4N2O4 — CID 53384853
6-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 53384853) has the molecular formula C20H16F4N2O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53384853 |
| Molecular Formula | C20H16F4N2O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 6-[2-(3-fluorophenyl)ethynyl]-N-(3-methyloxetan-3-yl)pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1(NC(=O)c2ccc(C#Cc3cccc(F)c3)nc2)COC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H15FN2O2.C2HF3O2/c1-18(11-23-12-18)21-17(22)14-6-8-16(20-10-14)7-5-13-3-2-4-15(19)9-13;3-2(4,5)1(6)7/h2-4,6,8-10H,11-12H2,1H3,(H,21,22);(H,6,7) |
| InChIKey | ZCYMRRBGAHGCHQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|