C25H23F3N2O3 — CID 53385199
1-benzyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid (PubChem CID 53385199) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is 1-benzyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53385199 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-benzyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(Cn2cc(CCOCc3ccccn3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H22N2O.C2HF3O2/c1-2-8-19(9-3-1)16-25-17-20(22-11-4-5-12-23(22)25)13-15-26-18-21-10-6-7-14-24-21;3-2(4,5)1(6)7/h1-12,14,17H,13,15-16,18H2;(H,6,7) |
| InChIKey | DQOIRQRJEVKYBR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|