About 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine
9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine (PubChem CID 53385610) has the molecular formula C14H13N7
and a molecular weight of 279.31 g/mol. Its IUPAC name is 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine.
Molecular Properties
| Compound Name | 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine |
| PubChem CID | 53385610 |
| Molecular Formula | C14H13N7 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine |
| SMILES | CN(C)c1ncc2ncn(-c3ccc4cn[nH]c4c3)c2n1 |
| InChI | InChI=1S/C14H13N7/c1-20(2)14-15-7-12-13(18-14)21(8-16-12)10-4-3-9-6-17-19-11(9)5-10/h3-8H,1-2H3,(H,17,19) |
| InChIKey | KBGOWQNHECVTPX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine?
The IUPAC name of 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine (CID 53385610) is 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine.
What is the SMILES notation for 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine?
The canonical SMILES for 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine is CN(C)c1ncc2ncn(-c3ccc4cn[nH]c4c3)c2n1.
What is the InChIKey of 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine?
The InChIKey is KBGOWQNHECVTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N7/c1-20(2)14-15-7-12-13(18-14)21(8-16-12)10-4-3-9-6-17-19-11(9)5-10/h3-8H,1-2H3,(H,17,19).
What are the key properties of 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine?
9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine has a molecular weight of 279.31 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1H-indazol-6-yl)-N,N-dimethylpurin-2-amine is sourced from PubChem (CID 53385610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).