C21H22F3N3O5 — CID 53386233
propan-2-yl (Z)-3-[3-[3-[(E)-3-oxo-3-propan-2-yloxyprop-1-enoxy]-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 53386233) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[3-[3-[(E)-3-oxo-3-propan-2-yloxyprop-1-enoxy]-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[3-[3-[(E)-3-oxo-3-propan-2-yloxyprop-1-enoxy]-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53386233 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | propan-2-yl (Z)-3-[3-[3-[(E)-3-oxo-3-propan-2-yloxyprop-1-enoxy]-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\n1cnc(-c2cc(O/C=C/C(=O)OC(C)C)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H22F3N3O5/c1-13(2)31-18(28)5-7-27-12-25-20(26-27)15-9-16(21(22,23)24)11-17(10-15)30-8-6-19(29)32-14(3)4/h5-14H,1-4H3/b7-5-,8-6+ |
| InChIKey | WJBGEGUKFZRCNV-CGXWXWIYSA-N |
| XLogP | 4.23 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|