C21H25F3N4O3 — CID 53386285
propan-2-yl (Z)-3-[3-[3-(2-pyrrolidin-1-ylethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 53386285) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[3-[3-(2-pyrrolidin-1-ylethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[3-[3-(2-pyrrolidin-1-ylethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53386285 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | propan-2-yl (Z)-3-[3-[3-(2-pyrrolidin-1-ylethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\n1cnc(-c2cc(OCCN3CCCC3)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H25F3N4O3/c1-15(2)31-19(29)5-8-28-14-25-20(26-28)16-11-17(21(22,23)24)13-18(12-16)30-10-9-27-6-3-4-7-27/h5,8,11-15H,3-4,6-7,9-10H2,1-2H3/b8-5- |
| InChIKey | SYKGZNSAXPOGIB-YVMONPNESA-N |
| XLogP | 3.86 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|