C13H17N5 — CID 5338630
N,N-diethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline (PubChem CID 5338630) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
|---|---|
| PubChem CID | 5338630 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N,N-diethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C13H17N5/c1-3-17(4-2)13-7-5-12(6-8-13)9-16-18-10-14-15-11-18/h5-11H,3-4H2,1-2H3/b16-9+ |
| InChIKey | WSGBPNOYRWKJBL-CXUHLZMHSA-N |
| XLogP | 2.01 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|