About N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline
N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline (PubChem CID 5338634) has the molecular formula C11H13N5
and a molecular weight of 215.26 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
| PubChem CID | 5338634 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline |
| SMILES | CN(C)c1ccc(/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C11H13N5/c1-15(2)11-5-3-10(4-6-11)7-14-16-8-12-13-9-16/h3-9H,1-2H3/b14-7+ |
| InChIKey | YDHQRSFAZYRBTA-VGOFMYFVSA-N |
| XLogP | 1.23 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline?
The IUPAC name of N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline (CID 5338634) is N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline.
What is the SMILES notation for N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline?
The canonical SMILES for N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline is CN(C)c1ccc(/C=N/n2cnnc2)cc1.
What is the InChIKey of N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline?
The InChIKey is YDHQRSFAZYRBTA-VGOFMYFVSA-N. The full InChI is InChI=1S/C11H13N5/c1-15(2)11-5-3-10(4-6-11)7-14-16-8-12-13-9-16/h3-9H,1-2H3/b14-7+.
What are the key properties of N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline?
N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline has a molecular weight of 215.26 g/mol, XLogP of 1.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[(E)-1,2,4-triazol-4-yliminomethyl]aniline is sourced from PubChem (CID 5338634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).