C48H40O12 — CID 53386436
2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,5-bis(phenylmethoxy)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (PubChem CID 53386436) has the molecular formula C48H40O12 and a molecular weight of 808.84 g/mol. Its IUPAC name is 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,5-bis(phenylmethoxy)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.
| Compound Name | 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,5-bis(phenylmethoxy)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 53386436 |
| Molecular Formula | C48H40O12 |
| Molecular Weight | 808.84 g/mol |
| Exact Mass | 808.25 |
| IUPAC Name | 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,5-bis(phenylmethoxy)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| SMILES | O=c1c(OCc2ccccc2)c(-c2ccc3c(c2)OC(c2ccccc2)(c2ccccc2)O3)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C48H40O12/c49-26-39-41(50)43(52)44(53)47(58-39)56-34-24-37(54-27-29-13-5-1-6-14-29)40-38(25-34)57-45(46(42(40)51)55-28-30-15-7-2-8-16-30)31-21-22-35-36(23-31)60-48(59-35,32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-25,39,41,43-44,47,49-50,52-53H,26-28H2/t39-,41-,43+,44-,47-/m1/s1 |
| InChIKey | YOCXRQLFRNYHCA-VDTRGQFKSA-N |
| XLogP | 6.47 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.84 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |