C18H36O3Si — CID 53386492
(E)-3-[(2R,3R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyloxolan-2-yl]but-2-en-1-ol (PubChem CID 53386492) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (E)-3-[(2R,3R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyloxolan-2-yl]but-2-en-1-ol.
| Compound Name | (E)-3-[(2R,3R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyloxolan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 53386492 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (E)-3-[(2R,3R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyloxolan-2-yl]but-2-en-1-ol |
| SMILES | C/C(=C\CO)[C@@H]1O[C@H](CCCO[Si](C)(C)C(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C18H36O3Si/c1-14(10-11-19)17-15(2)13-16(21-17)9-8-12-20-22(6,7)18(3,4)5/h10,15-17,19H,8-9,11-13H2,1-7H3/b14-10+/t15-,16-,17+/m1/s1 |
| InChIKey | RSOISHVQLFRFSJ-GODYTSNHSA-N |
| XLogP | 4.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|