C15H26O3Si — CID 53386548
(1R,2S,5R,6S)-3-ethenyl-1-methyl-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-ol (PubChem CID 53386548) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (1R,2S,5R,6S)-3-ethenyl-1-methyl-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-ol.
| Compound Name | (1R,2S,5R,6S)-3-ethenyl-1-methyl-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
|---|---|
| PubChem CID | 53386548 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (1R,2S,5R,6S)-3-ethenyl-1-methyl-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
| SMILES | C=CC1=C[C@@H](O[Si](CC)(CC)CC)[C@@H]2O[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C15H26O3Si/c1-6-11-10-12(14-15(5,17-14)13(11)16)18-19(7-2,8-3)9-4/h6,10,12-14,16H,1,7-9H2,2-5H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | ZUIGWWSDIHJVLH-CBBWQLFWSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|