C20H18ClNO6 — CID 53386632
[(E,4S)-4-(2-chlorophenyl)-1-ethoxy-5-nitro-1-oxopent-2-en-2-yl] benzoate (PubChem CID 53386632) has the molecular formula C20H18ClNO6 and a molecular weight of 403.82 g/mol. Its IUPAC name is [(E,4S)-4-(2-chlorophenyl)-1-ethoxy-5-nitro-1-oxopent-2-en-2-yl] benzoate.
| Compound Name | [(E,4S)-4-(2-chlorophenyl)-1-ethoxy-5-nitro-1-oxopent-2-en-2-yl] benzoate |
|---|---|
| PubChem CID | 53386632 |
| Molecular Formula | C20H18ClNO6 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [(E,4S)-4-(2-chlorophenyl)-1-ethoxy-5-nitro-1-oxopent-2-en-2-yl] benzoate |
| SMILES | CCOC(=O)/C(=C\[C@H](C[N+](=O)[O-])c1ccccc1Cl)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18ClNO6/c1-2-27-20(24)18(28-19(23)14-8-4-3-5-9-14)12-15(13-22(25)26)16-10-6-7-11-17(16)21/h3-12,15H,2,13H2,1H3/b18-12+/t15-/m1/s1 |
| InChIKey | BRRRGTIXFGYAGM-GYZOOYGHSA-N |
| XLogP | 4.00 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|