C22H17FO6 — CID 53386833
ethyl (4R)-4-(4-fluorophenyl)-2-hydroxy-5,10-dioxo-3,4-dihydrobenzo[g]chromene-2-carboxylate (PubChem CID 53386833) has the molecular formula C22H17FO6 and a molecular weight of 396.37 g/mol. Its IUPAC name is ethyl (4R)-4-(4-fluorophenyl)-2-hydroxy-5,10-dioxo-3,4-dihydrobenzo[g]chromene-2-carboxylate.
| Compound Name | ethyl (4R)-4-(4-fluorophenyl)-2-hydroxy-5,10-dioxo-3,4-dihydrobenzo[g]chromene-2-carboxylate |
|---|---|
| PubChem CID | 53386833 |
| Molecular Formula | C22H17FO6 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | ethyl (4R)-4-(4-fluorophenyl)-2-hydroxy-5,10-dioxo-3,4-dihydrobenzo[g]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1(O)C[C@H](c2ccc(F)cc2)C2=C(O1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H17FO6/c1-2-28-21(26)22(27)11-16(12-7-9-13(23)10-8-12)17-18(24)14-5-3-4-6-15(14)19(25)20(17)29-22/h3-10,16,27H,2,11H2,1H3/t16-,22?/m1/s1 |
| InChIKey | VZDOAHJROATOMS-XESZBRCGSA-N |
| XLogP | 2.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|