C36H40N4O4S — CID 53386868
4-[2-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]benzenesulfonamide (PubChem CID 53386868) has the molecular formula C36H40N4O4S and a molecular weight of 624.81 g/mol. Its IUPAC name is 4-[2-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53386868 |
| Molecular Formula | C36H40N4O4S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | 4-[2-[3',6'-bis(diethylamino)-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C36H40N4O4S/c1-5-38(6-2)26-15-19-31-33(23-26)44-34-24-27(39(7-3)8-4)16-20-32(34)36(31)30-12-10-9-11-29(30)35(41)40(36)22-21-25-13-17-28(18-14-25)45(37,42)43/h9-20,23-24H,5-8,21-22H2,1-4H3,(H2,37,42,43) |
| InChIKey | AXVQXDKRGPCGGE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|