C17H18O3 — CID 53386900
(6aS,10aS)-6a-acetyl-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one (PubChem CID 53386900) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (6aS,10aS)-6a-acetyl-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one.
| Compound Name | (6aS,10aS)-6a-acetyl-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 53386900 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (6aS,10aS)-6a-acetyl-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one |
| SMILES | CC(=O)[C@]12CC(C)=C(C)C[C@H]1c1ccccc1OC2=O |
| InChI | InChI=1S/C17H18O3/c1-10-8-14-13-6-4-5-7-15(13)20-16(19)17(14,12(3)18)9-11(10)2/h4-7,14H,8-9H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | RUJQPTNXHDOJSW-WMLDXEAASA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|