C19H17FN4O3 — CID 53386905
ethyl 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(113C)methyl(3,4-13C2,115N)pyrrolo[2,1-f](1,4-15N2)[1,2,4]triazine-6-carboxylate (PubChem CID 53386905) has the molecular formula C19H17FN4O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is ethyl 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(113C)methyl(3,4-13C2,115N)pyrrolo[2,1-f](1,4-15N2)[1,2,4]triazine-6-carboxylate.
| Compound Name | ethyl 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(113C)methyl(3,4-13C2,115N)pyrrolo[2,1-f](1,4-15N2)[1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 53386905 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(113C)methyl(3,4-13C2,115N)pyrrolo[2,1-f](1,4-15N2)[1,2,4]triazine-6-carboxylate |
| SMILES | CCO[13C](=O)[13c]1c[15n]2nc[15n]c(Oc3ccc4[nH]c(C)cc4c3F)c2[13c]1[13CH3] |
| InChI | InChI=1S/C19H17FN4O3/c1-4-26-19(25)13-8-24-17(11(13)3)18(21-9-22-24)27-15-6-5-14-12(16(15)20)7-10(2)23-14/h5-9,23H,4H2,1-3H3/i3+1,11+1,13+1,19+1,21+1,24+1 |
| InChIKey | ZRKQEIUACDKVOZ-DRAMFPFCSA-N |
| XLogP | 3.94 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |