C23H40O9 — CID 53387186
[(2E)-3,7,11-trimethyl-6-oxo-1-[(2R,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl]oxydodeca-2,10-dien-4-yl] acetate (PubChem CID 53387186) has the molecular formula C23H40O9 and a molecular weight of 460.56 g/mol. Its IUPAC name is [(2E)-3,7,11-trimethyl-6-oxo-1-[(2R,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl]oxydodeca-2,10-dien-4-yl] acetate.
| Compound Name | [(2E)-3,7,11-trimethyl-6-oxo-1-[(2R,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl]oxydodeca-2,10-dien-4-yl] acetate |
|---|---|
| PubChem CID | 53387186 |
| Molecular Formula | C23H40O9 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | [(2E)-3,7,11-trimethyl-6-oxo-1-[(2R,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl]oxydodeca-2,10-dien-4-yl] acetate |
| SMILES | CC(=O)OC(CC(=O)C(C)CCC=C(C)C)/C(C)=C/CO[C@@H]([C@H](O)[C@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C23H40O9/c1-14(2)7-6-8-15(3)18(27)11-21(32-17(5)26)16(4)9-10-31-23(20(29)13-25)22(30)19(28)12-24/h7,9,15,19-25,28-30H,6,8,10-13H2,1-5H3/b16-9+/t15?,19-,20-,21?,22-,23-/m1/s1 |
| InChIKey | SNXUZSSJIJDDDP-CQOVOOQLSA-N |
| XLogP | 0.66 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|