C22H19F6NO3S — CID 53387286
S-[[(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methyl] ethanethioate (PubChem CID 53387286) has the molecular formula C22H19F6NO3S and a molecular weight of 491.45 g/mol. Its IUPAC name is S-[[(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methyl] ethanethioate.
| Compound Name | S-[[(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 53387286 |
| Molecular Formula | C22H19F6NO3S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | S-[[(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC12CO[C@H](c3ccc(C(F)(F)F)cc3)N1[C@H](c1ccc(C(F)(F)F)cc1)OC2 |
| InChI | InChI=1S/C22H19F6NO3S/c1-13(30)33-12-20-10-31-18(14-2-6-16(7-3-14)21(23,24)25)29(20)19(32-11-20)15-4-8-17(9-5-15)22(26,27)28/h2-9,18-19H,10-12H2,1H3/t18-,19+,20? |
| InChIKey | KFODARNESANAKZ-YOFSQIOKSA-N |
| XLogP | 5.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|