C29H46O4 — CID 53387746
[3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] hex-5-ynoate (PubChem CID 53387746) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] hex-5-ynoate.
| Compound Name | [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] hex-5-ynoate |
|---|---|
| PubChem CID | 53387746 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | [3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]propyl] hex-5-ynoate |
| SMILES | C#CCCCC(=O)OCC(CO)OCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C29H46O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-25-32-28(26-30)27-33-29(31)24-22-6-4-2/h2,9-10,12-13,15-16,18-19,28,30H,3,5-8,11,14,17,20-27H2,1H3/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | BMSAEUSKGLUXTC-SNPVRQPZSA-N |
| XLogP | 6.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|