C19H20N2O3S — CID 53387889
5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 53387889) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 53387889 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(-c2nc(N)sc2-c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O3S/c1-11-5-7-12(8-6-11)18-16(21-19(20)25-18)13-9-14(22-2)17(24-4)15(10-13)23-3/h5-10H,1-4H3,(H2,20,21) |
| InChIKey | LOWCUEABOLQTAY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |