C23H26O4S — CID 53388014
(4aR,4bS,10aS)-3-methoxy-10a-methyl-4a-[(S)-(4-methylphenyl)sulfinyl]-4b,5,6,7,8,10-hexahydrophenanthrene-1,4-dione (PubChem CID 53388014) has the molecular formula C23H26O4S and a molecular weight of 398.52 g/mol. Its IUPAC name is (4aR,4bS,10aS)-3-methoxy-10a-methyl-4a-[(S)-(4-methylphenyl)sulfinyl]-4b,5,6,7,8,10-hexahydrophenanthrene-1,4-dione.
| Compound Name | (4aR,4bS,10aS)-3-methoxy-10a-methyl-4a-[(S)-(4-methylphenyl)sulfinyl]-4b,5,6,7,8,10-hexahydrophenanthrene-1,4-dione |
|---|---|
| PubChem CID | 53388014 |
| Molecular Formula | C23H26O4S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (4aR,4bS,10aS)-3-methoxy-10a-methyl-4a-[(S)-(4-methylphenyl)sulfinyl]-4b,5,6,7,8,10-hexahydrophenanthrene-1,4-dione |
| SMILES | COC1=CC(=O)[C@]2(C)CC=C3CCCC[C@@H]3[C@]2([S@@](=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C23H26O4S/c1-15-8-10-17(11-9-15)28(26)23-18-7-5-4-6-16(18)12-13-22(23,2)20(24)14-19(27-3)21(23)25/h8-12,14,18H,4-7,13H2,1-3H3/t18-,22-,23-,28-/m0/s1 |
| InChIKey | UMRBGSAZMFCRGS-SBZQNBARSA-N |
| XLogP | 4.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|