C16H10BrF2NO — CID 53388125
5-(4-bromophenyl)-2,2-difluoro-N-phenylfuran-3-imine (PubChem CID 53388125) has the molecular formula C16H10BrF2NO and a molecular weight of 350.16 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2,2-difluoro-N-phenylfuran-3-imine.
| Compound Name | 5-(4-bromophenyl)-2,2-difluoro-N-phenylfuran-3-imine |
|---|---|
| PubChem CID | 53388125 |
| Molecular Formula | C16H10BrF2NO |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 5-(4-bromophenyl)-2,2-difluoro-N-phenylfuran-3-imine |
| SMILES | FC1(F)OC(c2ccc(Br)cc2)=C/C1=N\c1ccccc1 |
| InChI | InChI=1S/C16H10BrF2NO/c17-12-8-6-11(7-9-12)14-10-15(16(18,19)21-14)20-13-4-2-1-3-5-13/h1-10H/b20-15+ |
| InChIKey | RLTLKNGJPAPXGD-HMMYKYKNSA-N |
| XLogP | 5.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|