C16H18N6S — CID 53388196
2-N-ethyl-6-N-(5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-yl)pyridine-2,6-diamine (PubChem CID 53388196) has the molecular formula C16H18N6S and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-yl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 53388196 |
| Molecular Formula | C16H18N6S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-N-ethyl-6-N-(5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-yl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2nc3c(s2)CCCc2[nH]ncc2-3)n1 |
| InChI | InChI=1S/C16H18N6S/c1-2-17-13-7-4-8-14(19-13)20-16-21-15-10-9-18-22-11(10)5-3-6-12(15)23-16/h4,7-9H,2-3,5-6H2,1H3,(H,18,22)(H2,17,19,20,21) |
| InChIKey | YVNDLPWNERWEJX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |