C28H20N2O5S2 — CID 53388199
2-[5-(1-benzothiophen-2-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione (PubChem CID 53388199) has the molecular formula C28H20N2O5S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-[5-(1-benzothiophen-2-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(1-benzothiophen-2-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53388199 |
| Molecular Formula | C28H20N2O5S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-[5-(1-benzothiophen-2-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
| SMILES | COc1cc(-c2nc(N3C(=O)c4ccccc4C3=O)sc2-c2cc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C28H20N2O5S2/c1-33-19-12-16(13-20(34-2)24(19)35-3)23-25(22-14-15-8-4-7-11-21(15)36-22)37-28(29-23)30-26(31)17-9-5-6-10-18(17)27(30)32/h4-14H,1-3H3 |
| InChIKey | BBSRNDHXJXSTPD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|