C27H21FN2O6S — CID 53388369
2-[5-(3-fluoro-4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione (PubChem CID 53388369) has the molecular formula C27H21FN2O6S and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-[5-(3-fluoro-4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(3-fluoro-4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53388369 |
| Molecular Formula | C27H21FN2O6S |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[5-(3-fluoro-4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2sc(N3C(=O)c4ccccc4C3=O)nc2-c2cc(OC)c(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C27H21FN2O6S/c1-33-19-10-9-14(11-18(19)28)24-22(15-12-20(34-2)23(36-4)21(13-15)35-3)29-27(37-24)30-25(31)16-7-5-6-8-17(16)26(30)32/h5-13H,1-4H3 |
| InChIKey | LQGUPEXEWIZEFS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|