C25H19N3 — CID 53388452
(3R,4R,5R,6S)-3-phenyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene-4,5-dicarbonitrile (PubChem CID 53388452) has the molecular formula C25H19N3 and a molecular weight of 361.45 g/mol. Its IUPAC name is (3R,4R,5R,6S)-3-phenyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene-4,5-dicarbonitrile.
| Compound Name | (3R,4R,5R,6S)-3-phenyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 53388452 |
| Molecular Formula | C25H19N3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (3R,4R,5R,6S)-3-phenyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene-4,5-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@@H](C#N)[C@H](c2ccccc2)N2c3ccccc3Cc3ccccc3[C@H]12 |
| InChI | InChI=1S/C25H19N3/c26-15-21-22(16-27)25-20-12-6-4-10-18(20)14-19-11-5-7-13-23(19)28(25)24(21)17-8-2-1-3-9-17/h1-13,21-22,24-25H,14H2/t21-,22-,24+,25-/m1/s1 |
| InChIKey | MIORPWOYBYWDOP-YQIMAOPZSA-N |
| XLogP | 5.17 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |