C22H34O4Si — CID 53388458
methyl (3aS,7aR)-2,2-dimethyl-7-[2-tri(propan-2-yl)silylethynyl]-7aH-1,3-benzodioxole-3a-carboxylate (PubChem CID 53388458) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is methyl (3aS,7aR)-2,2-dimethyl-7-[2-tri(propan-2-yl)silylethynyl]-7aH-1,3-benzodioxole-3a-carboxylate.
| Compound Name | methyl (3aS,7aR)-2,2-dimethyl-7-[2-tri(propan-2-yl)silylethynyl]-7aH-1,3-benzodioxole-3a-carboxylate |
|---|---|
| PubChem CID | 53388458 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl (3aS,7aR)-2,2-dimethyl-7-[2-tri(propan-2-yl)silylethynyl]-7aH-1,3-benzodioxole-3a-carboxylate |
| SMILES | COC(=O)[C@]12C=CC=C(C#C[Si](C(C)C)(C(C)C)C(C)C)[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C22H34O4Si/c1-15(2)27(16(3)4,17(5)6)14-12-18-11-10-13-22(20(23)24-9)19(18)25-21(7,8)26-22/h10-11,13,15-17,19H,1-9H3/t19-,22+/m1/s1 |
| InChIKey | AHQUSXDNYMRNMT-KNQAVFIVSA-N |
| XLogP | 4.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|