About 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione
6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 53388506) has the molecular formula C19H16N2O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione.
Molecular Properties
| Compound Name | 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione |
| PubChem CID | 53388506 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | NCC(O)Cn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C19H16N2O3/c20-9-11(22)10-21-17-13-6-2-3-7-14(13)18(23)16(17)12-5-1-4-8-15(12)19(21)24/h1-8,11,22H,9-10,20H2 |
| InChIKey | HHLLMRFSKVNTSS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione?
The IUPAC name of 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione (CID 53388506) is 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione.
What is the SMILES notation for 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione?
The canonical SMILES for 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione is NCC(O)Cn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2.
What is the InChIKey of 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione?
The InChIKey is HHLLMRFSKVNTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3/c20-9-11(22)10-21-17-13-6-2-3-7-14(13)18(23)16(17)12-5-1-4-8-15(12)19(21)24/h1-8,11,22H,9-10,20H2.
What are the key properties of 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione?
6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione has a molecular weight of 320.35 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-amino-2-hydroxypropyl)indeno[1,2-c]isoquinoline-5,11-dione is sourced from PubChem (CID 53388506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).