C23H31NO — CID 53388523
N-[2-(2,2,6,6-tetramethyl-4-phenyloxan-4-yl)ethyl]aniline (PubChem CID 53388523) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is N-[2-(2,2,6,6-tetramethyl-4-phenyloxan-4-yl)ethyl]aniline.
| Compound Name | N-[2-(2,2,6,6-tetramethyl-4-phenyloxan-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 53388523 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-[2-(2,2,6,6-tetramethyl-4-phenyloxan-4-yl)ethyl]aniline |
| SMILES | CC1(C)CC(CCNc2ccccc2)(c2ccccc2)CC(C)(C)O1 |
| InChI | InChI=1S/C23H31NO/c1-21(2)17-23(18-22(3,4)25-21,19-11-7-5-8-12-19)15-16-24-20-13-9-6-10-14-20/h5-14,24H,15-18H2,1-4H3 |
| InChIKey | ZLFMQBZRZIATAG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |