C23H30ClNS — CID 53388673
3-chloro-N-[2-(2,2,6,6-tetramethyl-4-phenylthian-4-yl)ethyl]aniline (PubChem CID 53388673) has the molecular formula C23H30ClNS and a molecular weight of 388.02 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,2,6,6-tetramethyl-4-phenylthian-4-yl)ethyl]aniline.
| Compound Name | 3-chloro-N-[2-(2,2,6,6-tetramethyl-4-phenylthian-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 53388673 |
| Molecular Formula | C23H30ClNS |
| Molecular Weight | 388.02 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-chloro-N-[2-(2,2,6,6-tetramethyl-4-phenylthian-4-yl)ethyl]aniline |
| SMILES | CC1(C)CC(CCNc2cccc(Cl)c2)(c2ccccc2)CC(C)(C)S1 |
| InChI | InChI=1S/C23H30ClNS/c1-21(2)16-23(17-22(3,4)26-21,18-9-6-5-7-10-18)13-14-25-20-12-8-11-19(24)15-20/h5-12,15,25H,13-14,16-17H2,1-4H3 |
| InChIKey | XDZIFXRLJFPNPG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.02 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |