C13H22O3 — CID 53388768
(2E,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-one (PubChem CID 53388768) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2E,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-one.
| Compound Name | (2E,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-one |
|---|---|
| PubChem CID | 53388768 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2E,6Z,8R)-9-(methoxymethoxy)-6,8-dimethylnona-2,6-dien-4-one |
| SMILES | C/C=C/C(=O)C/C(C)=C\[C@@H](C)COCOC |
| InChI | InChI=1S/C13H22O3/c1-5-6-13(14)8-11(2)7-12(3)9-16-10-15-4/h5-7,12H,8-10H2,1-4H3/b6-5+,11-7-/t12-/m1/s1 |
| InChIKey | BOGYLAVHINXUHN-HTWZPSIPSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|