C39H42N2O3 — CID 53389234
2-[4-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)pentyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 53389234) has the molecular formula C39H42N2O3 and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)pentyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)pentyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 53389234 |
| Molecular Formula | C39H42N2O3 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)pentyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCC[C@H](NC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(-c2ccccc2C(=O)O)cc1)c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C39H42N2O3/c1-6-7-15-36(31-12-10-11-30(22-31)25(2)3)40-38(42)32-20-21-37-35(23-32)26(4)27(5)41(37)24-28-16-18-29(19-17-28)33-13-8-9-14-34(33)39(43)44/h8-14,16-23,25,36H,6-7,15,24H2,1-5H3,(H,40,42)(H,43,44)/t36-/m0/s1 |
| InChIKey | RDCMWNANKKFTAL-BHVANESWSA-N |
| XLogP | 9.46 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|