C10H6F4N4O4S — CID 53389267
methyl 1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazole-4-carboxylate (PubChem CID 53389267) has the molecular formula C10H6F4N4O4S and a molecular weight of 354.24 g/mol. Its IUPAC name is methyl 1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 53389267 |
| Molecular Formula | C10H6F4N4O4S |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | methyl 1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2c(F)c(F)c(S(N)(=O)=O)c(F)c2F)nn1 |
| InChI | InChI=1S/C10H6F4N4O4S/c1-22-10(19)3-2-18(17-16-3)8-4(11)6(13)9(23(15,20)21)7(14)5(8)12/h2H,1H3,(H2,15,20,21) |
| InChIKey | SZIXXXYRUPCZBK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|