C20H30O8 — CID 53389296
(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,9,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 53389296) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,9,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,9,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 53389296 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,9,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)[C@@]3(C)[C@H]([C@H](O)[C@](O)(C[C@@H]1O)C2(C)C)[C@]1(O)CO[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C20H30O8/c1-8-9(21)6-20(27)16(25)14-18(4,10(22)5-11-19(14,26)7-28-11)15(24)13(23)12(8)17(20,2)3/h9-11,13-14,16,21-23,25-27H,5-7H2,1-4H3/t9-,10-,11+,13+,14-,16-,18+,19-,20+/m0/s1 |
| InChIKey | RDHYTEHLFAGCRE-CZDNZVSQSA-N |
| XLogP | -1.35 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|