About 2-ethylhexylurea
2-ethylhexylurea (PubChem CID 533894) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethylhexylurea.
Molecular Properties
| Compound Name | 2-ethylhexylurea |
| PubChem CID | 533894 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-ethylhexylurea |
| SMILES | CCCCC(CC)CNC(N)=O |
| InChI | InChI=1S/C9H20N2O/c1-3-5-6-8(4-2)7-11-9(10)12/h8H,3-7H2,1-2H3,(H3,10,11,12) |
| InChIKey | XUGUGGFZFUIRAE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylurea?
The IUPAC name of 2-ethylhexylurea (CID 533894) is 2-ethylhexylurea.
What is the SMILES notation for 2-ethylhexylurea?
The canonical SMILES for 2-ethylhexylurea is CCCCC(CC)CNC(N)=O.
What is the InChIKey of 2-ethylhexylurea?
The InChIKey is XUGUGGFZFUIRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-3-5-6-8(4-2)7-11-9(10)12/h8H,3-7H2,1-2H3,(H3,10,11,12).
What are the key properties of 2-ethylhexylurea?
2-ethylhexylurea has a molecular weight of 172.27 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylurea is sourced from PubChem (CID 533894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).