C19H26N2O — CID 5338983
(2Z)-1-(azepan-1-yl)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone (PubChem CID 5338983) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (2Z)-1-(azepan-1-yl)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone.
| Compound Name | (2Z)-1-(azepan-1-yl)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 5338983 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (2Z)-1-(azepan-1-yl)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
| SMILES | CC1(C)Cc2ccccc2/C(=C/C(=O)N2CCCCCC2)N1 |
| InChI | InChI=1S/C19H26N2O/c1-19(2)14-15-9-5-6-10-16(15)17(20-19)13-18(22)21-11-7-3-4-8-12-21/h5-6,9-10,13,20H,3-4,7-8,11-12,14H2,1-2H3/b17-13- |
| InChIKey | QNQQSQDYEDCAKM-LGMDPLHJSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|