C24H22N4O3S — CID 53389933
N-cyclopropyl-4-(8-ethylsulfonyl-6-phenylimidazo[1,2-a]pyrazin-3-yl)benzamide (PubChem CID 53389933) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-cyclopropyl-4-(8-ethylsulfonyl-6-phenylimidazo[1,2-a]pyrazin-3-yl)benzamide.
| Compound Name | N-cyclopropyl-4-(8-ethylsulfonyl-6-phenylimidazo[1,2-a]pyrazin-3-yl)benzamide |
|---|---|
| PubChem CID | 53389933 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-cyclopropyl-4-(8-ethylsulfonyl-6-phenylimidazo[1,2-a]pyrazin-3-yl)benzamide |
| SMILES | CCS(=O)(=O)c1nc(-c2ccccc2)cn2c(-c3ccc(C(=O)NC4CC4)cc3)cnc12 |
| InChI | InChI=1S/C24H22N4O3S/c1-2-32(30,31)24-22-25-14-21(28(22)15-20(27-24)16-6-4-3-5-7-16)17-8-10-18(11-9-17)23(29)26-19-12-13-19/h3-11,14-15,19H,2,12-13H2,1H3,(H,26,29) |
| InChIKey | ORXLRIPWJGQAGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |