C32H37NO7 — CID 53391397
2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]-N-[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetamide (PubChem CID 53391397) has the molecular formula C32H37NO7 and a molecular weight of 547.65 g/mol. Its IUPAC name is 2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]-N-[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetamide.
| Compound Name | 2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]-N-[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetamide |
|---|---|
| PubChem CID | 53391397 |
| Molecular Formula | C32H37NO7 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]-N-[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)COc2ccc(C(=O)/C=C/c3ccccc3)cc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C32H37NO7/c1-20-9-15-26-21(2)29(37-30-32(26)25(20)17-18-31(3,38-30)39-40-32)33-28(35)19-36-24-13-11-23(12-14-24)27(34)16-10-22-7-5-4-6-8-22/h4-8,10-14,16,20-21,25-26,29-30H,9,15,17-19H2,1-3H3,(H,33,35)/b16-10+/t20-,21-,25+,26+,29+,30-,31+,32-/m1/s1 |
| InChIKey | ACGLKUUVGWMDJD-FTAYVYRZSA-N |
| XLogP | 5.29 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|