C25H18IN3O4 — CID 53391642
9-(5-iodofuran-2-yl)-12,14-dimethyl-17-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 53391642) has the molecular formula C25H18IN3O4 and a molecular weight of 551.34 g/mol. Its IUPAC name is 9-(5-iodofuran-2-yl)-12,14-dimethyl-17-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | 9-(5-iodofuran-2-yl)-12,14-dimethyl-17-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 53391642 |
| Molecular Formula | C25H18IN3O4 |
| Molecular Weight | 551.34 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 9-(5-iodofuran-2-yl)-12,14-dimethyl-17-phenyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n3c(c2n(C)c1=O)C(c1ccc(I)o1)Oc1ccccc1-3 |
| InChI | InChI=1S/C25H18IN3O4/c1-27-21-19(24(30)28(2)25(27)31)20(14-8-4-3-5-9-14)29-15-10-6-7-11-16(15)33-23(22(21)29)17-12-13-18(26)32-17/h3-13,23H,1-2H3 |
| InChIKey | RJHCLYJXUNDUIS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|