C16H13N3O4 — CID 53392432
6-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 53392432) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53392432 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 6-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | CN1C(=O)c2cccc(CNc3ccc(C(=O)O)cn3)c2C1=O |
| InChI | InChI=1S/C16H13N3O4/c1-19-14(20)11-4-2-3-9(13(11)15(19)21)7-17-12-6-5-10(8-18-12)16(22)23/h2-6,8H,7H2,1H3,(H,17,18)(H,22,23) |
| InChIKey | UVVXUGHJMOMOHE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|