C34H44O5Si — CID 53392636
(4S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-4-hydroxy-3,3-dimethyloxan-2-one (PubChem CID 53392636) has the molecular formula C34H44O5Si and a molecular weight of 560.81 g/mol. Its IUPAC name is (4S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-4-hydroxy-3,3-dimethyloxan-2-one.
| Compound Name | (4S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-4-hydroxy-3,3-dimethyloxan-2-one |
|---|---|
| PubChem CID | 53392636 |
| Molecular Formula | C34H44O5Si |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | (4S,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]-4-hydroxy-3,3-dimethyloxan-2-one |
| SMILES | CC1(C)C(=O)O[C@H](C[C@H](CCOCc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C34H44O5Si/c1-33(2,3)40(29-17-11-7-12-18-29,30-19-13-8-14-20-30)39-27(21-22-37-25-26-15-9-6-10-16-26)23-28-24-31(35)34(4,5)32(36)38-28/h6-20,27-28,31,35H,21-25H2,1-5H3/t27-,28+,31-/m0/s1 |
| InChIKey | LHRPVOQXUDCRTN-QXIHQKPUSA-N |
| XLogP | 5.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|