About 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride
4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride (PubChem CID 53392693) has the molecular formula C16H14ClN3O2
and a molecular weight of 315.76 g/mol. Its IUPAC name is 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride |
| PubChem CID | 53392693 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2C(=O)c3cccc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C16H13N3O2.ClH/c1-9-3-2-4-12-13(9)16(21)19(15(12)20)11-7-5-10(6-8-11)14(17)18;/h2-8H,1H3,(H3,17,18);1H |
| InChIKey | RAMZBLIVAVVELY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride?
The IUPAC name of 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride (CID 53392693) is 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride.
What is the SMILES notation for 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride?
The canonical SMILES for 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride is Cl.[H]/N=C(\N)c1ccc(N2C(=O)c3cccc(C)c3C2=O)cc1.
What is the InChIKey of 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride?
The InChIKey is RAMZBLIVAVVELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2.ClH/c1-9-3-2-4-12-13(9)16(21)19(15(12)20)11-7-5-10(6-8-11)14(17)18;/h2-8H,1H3,(H3,17,18);1H.
What are the key properties of 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride?
4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride has a molecular weight of 315.76 g/mol, XLogP of 2.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,3-dioxoisoindol-2-yl)benzenecarboximidamide;hydrochloride is sourced from PubChem (CID 53392693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).