C35H17F9O2 — CID 53392752
1,2,4-tris[4-(trifluoromethyl)phenyl]anthracene-9,10-dione (PubChem CID 53392752) has the molecular formula C35H17F9O2 and a molecular weight of 640.50 g/mol. Its IUPAC name is 1,2,4-tris[4-(trifluoromethyl)phenyl]anthracene-9,10-dione.
| Compound Name | 1,2,4-tris[4-(trifluoromethyl)phenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 53392752 |
| Molecular Formula | C35H17F9O2 |
| Molecular Weight | 640.50 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 1,2,4-tris[4-(trifluoromethyl)phenyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(-c1ccc(C(F)(F)F)cc1)cc(-c1ccc(C(F)(F)F)cc1)c2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H17F9O2/c36-33(37,38)21-11-5-18(6-12-21)26-17-27(19-7-13-22(14-8-19)34(39,40)41)29-30(32(46)25-4-2-1-3-24(25)31(29)45)28(26)20-9-15-23(16-10-20)35(42,43)44/h1-17H |
| InChIKey | IMFOQYSALQUGQG-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.50 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|